4-(3-Chloro-4-methylphenyl)-5-methyl-1,3-thiazol-2-amine structure
|
Common Name | 4-(3-Chloro-4-methylphenyl)-5-methyl-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 175278-40-7 | Molecular Weight | 238.73600 | |
| Density | 1.296g/cm3 | Boiling Point | 388.7ºC at 760mmHg | |
| Molecular Formula | C11H11ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.9ºC | |
| Name | 4-(3-Chloro-4-methylphenyl)-5-methyl-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 388.7ºC at 760mmHg |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.73600 |
| Flash Point | 188.9ºC |
| Exact Mass | 238.03300 |
| PSA | 67.88000 |
| LogP | 3.59260 |
| Vapour Pressure | 3.01E-06mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | YMIXNQPUCSSBIW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nc(N)sc2C)cc1Cl |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-amino-4-(3-chloro-4-methylphenyl)-5-methylthiazole |