methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate
Modify Date: 2026-06-20 16:53:09
methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate structure
|
Common Name | methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate | ||
|---|---|---|---|---|
| CAS Number | 175281-79-5 | Molecular Weight | 266.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18O5 |
|---|---|
| Molecular Weight | 266.29000 |
| Exact Mass | 266.11500 |
| PSA | 61.83000 |
| LogP | 2.22980 |
| InChIKey | FDYRREZPFMKGDZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCOc1ccc(C(C)=O)cc1OC |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 4-(4-acetyl-2-methoxyphenoxy)butyrate |
| Methyl 4-((4-acetyl-2-methoxy)phenoxy)butanoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate? |
| A: Molecular weight of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate is 266.29000. |
| Q: What is the Chinese name of 175281-79-5? |
| A: Chinese name of 175281-79-5 is 175281-79-5. |
| Q: What is the SMILES notation of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate? |
| A: SMILES notation of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate is COC(=O)CCCOc1ccc(C(C)=O)cc1OC. |
| Q: What is the polar surface area (PSA) of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate? |
| A: Polar surface area (PSA) of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate is 61.83000. |
| Q: What is the CAS number of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate? |
| A: CAS number of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate is 175281-79-5. |
| Q: What English synonyms does methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate have? |
| A: English synonyms of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate: methyl 4-(4-acetyl-2-methoxyphenoxy)butyrate, Methyl 4-((4-acetyl-2-methoxy)phenoxy)butanoate. |
| Q: What is the LogP of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate? |
| A: LogP of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate is 2.22980. |
| Q: What is the InChIKey of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate? |
| A: InChIKey of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate is FDYRREZPFMKGDZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate? |
| A: Molecular formula of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate is C14H18O5. |
| Q: What is the English name of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate? |
| A: The English name of methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate is methyl 4-(4-acetyl-2-methoxyphenoxy)butanoate. |