Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate structure
|
Common Name | Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate | ||
|---|---|---|---|---|
| CAS Number | 175283-85-9 | Molecular Weight | 537.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17N3Na2O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H17N3Na2O8S2 |
|---|---|
| Molecular Weight | 537.5 |
| InChIKey | QIDWIUJXEDQIKN-UHFFFAOYSA-L |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])c(N=Nc3ccc(C)cc3C)c(O)c12.[Na+].[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate? |
| A: Molecular formula of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate is C20H17N3Na2O8S2. |
| Q: What is the molecular weight of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate? |
| A: Molecular weight of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate is 537.5. |
| Q: What is the SMILES notation of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate? |
| A: SMILES notation of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate is CC(=O)Nc1cc(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])c(N=Nc3ccc(C)cc3C)c(O)c12.[Na+].[Na+]. |
| Q: What is the InChIKey of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate? |
| A: InChIKey of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate is QIDWIUJXEDQIKN-UHFFFAOYSA-L. |
| Q: What is the CAS number of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate? |
| A: CAS number of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate is 175283-85-9. |
| Q: What is the Chinese name of 175283-85-9? |
| A: Chinese name of 175283-85-9 is 175283-85-9. |
| Q: What is the English name of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate? |
| A: The English name of Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate is Disodium 5-acetamido-3-((2,4-dimethylphenyl)diazenyl)-4-hydroxy-2,7-naphthalenedisulfonate. |