tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate
![tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate Structure](https://image.chemsrc.com/caspic/386/175293-79-5.png)
tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate structure
|
Common Name | tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 175293-79-5 | Molecular Weight | 312.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16N2O4 |
|---|---|
| Molecular Weight | 312.32000 |
| Exact Mass | 312.11100 |
| PSA | 87.91000 |
| LogP | 4.70780 |
| InChIKey | QJULNRDQFRCIAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1[nH]cc2c1ccc1c([N+](=O)[O-])cccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
tert-butyl 6-ni... CAS#:175293-79-5 |
| Literature: Lash, Timothy D.; Wijesinghe, Chaminda; Osuma, Augustine T.; Patel, Jyoti R. Tetrahedron Letters, 1997 , vol. 38, # 12 p. 2031 - 2034 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 175293-79-5? |
| A: Chinese name of 175293-79-5 is 175293-79-5. |
| Q: What is the LogP of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate? |
| A: LogP of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate is 4.70780. |
| Q: What is the English name of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate? |
| A: The English name of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate is tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate. |
| Q: What is the polar surface area (PSA) of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate? |
| A: Polar surface area (PSA) of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate is 87.91000. |
| Q: What is the InChIKey of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate? |
| A: InChIKey of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate is QJULNRDQFRCIAS-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate? |
| A: SMILES notation of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate is CC(C)(C)OC(=O)c1[nH]cc2c1ccc1c([N+](=O)[O-])cccc12. |
| Q: What is the molecular weight of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate? |
| A: Molecular weight of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate is 312.32000. |
| Q: What is the CAS number of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate? |
| A: CAS number of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate is 175293-79-5. |
| Q: What is the molecular formula of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate? |
| A: Molecular formula of tert-butyl 6-nitro-2H-benzo[e]isoindole-3-carboxylate is C17H16N2O4. |