P'-hydroxymesocarb
Modify Date: 2025-09-07 20:01:11
P'-hydroxymesocarb structure
|
Common Name | P'-hydroxymesocarb | ||
|---|---|---|---|---|
| CAS Number | 175296-79-4 | Molecular Weight | 338.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | P'-hydroxymesocarb |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H18N4O3 |
|---|---|
| Molecular Weight | 338.4 |
| InChIKey | GONKDVCPACJNBP-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccc(O)cc1)[n+]1cc(N=C([O-])Nc2ccccc2)on1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of P'-hydroxymesocarb? |
| A: Molecular weight of P'-hydroxymesocarb is 338.4. |
| Q: What is the English name of P'-hydroxymesocarb? |
| A: The English name of P'-hydroxymesocarb is P'-hydroxymesocarb. |
| Q: What is the molecular formula of P'-hydroxymesocarb? |
| A: Molecular formula of P'-hydroxymesocarb is C18H18N4O3. |
| Q: What is the SMILES notation of P'-hydroxymesocarb? |
| A: SMILES notation of P'-hydroxymesocarb is CC(Cc1ccc(O)cc1)[n+]1cc(N=C([O-])Nc2ccccc2)on1. |
| Q: What is the CAS number of P'-hydroxymesocarb? |
| A: CAS number of P'-hydroxymesocarb is 175296-79-4. |
| Q: What is the InChIKey of P'-hydroxymesocarb? |
| A: InChIKey of P'-hydroxymesocarb is GONKDVCPACJNBP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 175296-79-4? |
| A: Chinese name of 175296-79-4 is 175296-79-4. |