1,4-Benzenediol,2,5-bis(1-piperidinylmethyl)- structure
|
Common Name | 1,4-Benzenediol,2,5-bis(1-piperidinylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1753-68-0 | Molecular Weight | 304.42700 | |
| Density | 1.175g/cm3 | Boiling Point | 463.5ºC at 760mmHg | |
| Molecular Formula | C18H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232ºC | |
| Name | 2,5-bis(piperidin-1-ylmethyl)benzene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 463.5ºC at 760mmHg |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.42700 |
| Flash Point | 232ºC |
| Exact Mass | 304.21500 |
| PSA | 46.94000 |
| LogP | 2.94540 |
| Vapour Pressure | 3.25E-09mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | NGSODXNPVIELMQ-UHFFFAOYSA-N |
| SMILES | Oc1cc(CN2CCCCC2)c(O)cc1CN1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-Bis-piperidin-1-ylmethyl-benzene-1,4-diol |
| 2,5-Bis-piperidinomethyl-hydrochinon |
| 2,5-Bis-(piperidinomethyl)-quinol |
| 2.5-Bis-<dipiperidinomethyl>-hydrochinon |