2-(4-methylphenyl)sulfinyl-1-phenylethanone
Modify Date: 2026-04-08 09:16:30
2-(4-methylphenyl)sulfinyl-1-phenylethanone structure
|
Common Name | 2-(4-methylphenyl)sulfinyl-1-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 17530-89-1 | Molecular Weight | 258.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-methylphenyl)sulfinyl-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O2S |
|---|---|
| Molecular Weight | 258.33500 |
| Exact Mass | 258.07100 |
| PSA | 53.35000 |
| LogP | 3.85120 |
| InChIKey | JQIQTCZCJCVZOX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)CC(=O)c2ccccc2)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-tolyl phenacyl sulfoxide |
| phenacyl p-tolyl sulfoxide |
| p-tolyl phenacyl sulphoxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 17530-89-1? |
| A: Chinese name of 17530-89-1 is 17530-89-1. |
| Q: What is the CAS number of 2-(4-methylphenyl)sulfinyl-1-phenylethanone? |
| A: CAS number of 2-(4-methylphenyl)sulfinyl-1-phenylethanone is 17530-89-1. |
| Q: What is the English name of 2-(4-methylphenyl)sulfinyl-1-phenylethanone? |
| A: The English name of 2-(4-methylphenyl)sulfinyl-1-phenylethanone is 2-(4-methylphenyl)sulfinyl-1-phenylethanone. |
| Q: What is the SMILES notation of 2-(4-methylphenyl)sulfinyl-1-phenylethanone? |
| A: SMILES notation of 2-(4-methylphenyl)sulfinyl-1-phenylethanone is Cc1ccc(S(=O)CC(=O)c2ccccc2)cc1. |
| Q: What is the molecular weight of 2-(4-methylphenyl)sulfinyl-1-phenylethanone? |
| A: Molecular weight of 2-(4-methylphenyl)sulfinyl-1-phenylethanone is 258.33500. |
| Q: What is the LogP of 2-(4-methylphenyl)sulfinyl-1-phenylethanone? |
| A: LogP of 2-(4-methylphenyl)sulfinyl-1-phenylethanone is 3.85120. |
| Q: What is the InChIKey of 2-(4-methylphenyl)sulfinyl-1-phenylethanone? |
| A: InChIKey of 2-(4-methylphenyl)sulfinyl-1-phenylethanone is JQIQTCZCJCVZOX-UHFFFAOYSA-N. |
| Q: What English synonyms does 2-(4-methylphenyl)sulfinyl-1-phenylethanone have? |
| A: English synonyms of 2-(4-methylphenyl)sulfinyl-1-phenylethanone: p-tolyl phenacyl sulfoxide, phenacyl p-tolyl sulfoxide, p-tolyl phenacyl sulphoxide. |
| Q: What is the molecular formula of 2-(4-methylphenyl)sulfinyl-1-phenylethanone? |
| A: Molecular formula of 2-(4-methylphenyl)sulfinyl-1-phenylethanone is C15H14O2S. |
| Q: What is the polar surface area (PSA) of 2-(4-methylphenyl)sulfinyl-1-phenylethanone? |
| A: Polar surface area (PSA) of 2-(4-methylphenyl)sulfinyl-1-phenylethanone is 53.35000. |