1,2-Benzenediacetic acid diethyl ester structure
|
Common Name | 1,2-Benzenediacetic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 17532-66-0 | Molecular Weight | 250.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[2-(2-ethoxy-2-oxoethyl)phenyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O4 |
|---|---|
| Molecular Weight | 250.29000 |
| Exact Mass | 250.12100 |
| PSA | 52.60000 |
| LogP | 1.89780 |
| InChIKey | GTHDFYARNWTZJG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccccc1CC(=O)OCC |
| HS Code | 2917399090 |
|---|
|
~84%
1,2-Benzenediac... CAS#:17532-66-0 |
| Literature: Krafft, Marie E.; Schmidt, Peter Synthetic Communications, 2002 , vol. 32, # 17 p. 2723 - 2732 |
|
~%
1,2-Benzenediac... CAS#:17532-66-0 |
| Literature: Raucher,S.; Lui,A.S.-T. Journal of the American Chemical Society, 1978 , vol. 100, # 15 p. 4902 - 4903 |
|
~%
1,2-Benzenediac... CAS#:17532-66-0 |
| Literature: Luca, Carlo de; Inesi, Achille; Rampazzo, Liliana Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 12 p. 1821 - 1826 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Diethyl o-benzoldiacetat |
| o-phenylenedi-acetic acid diethyl ester |
| 1,2-Benzenediacetic acid,diethyl ester |
| o-Phenylendi-essigsaeure-diaethylester |
| diethyl benzene-1,2-diacetate |
| diethyl 1,2-benzenediacetate |