2,7-dibromo-4,5,9,10-tetrahydropyrene
2,7-dibromo-4,5,9,10-tetrahydropyrene structure
|
Common Name | 2,7-dibromo-4,5,9,10-tetrahydropyrene | ||
|---|---|---|---|---|
| CAS Number | 17533-36-7 | Molecular Weight | 364.07400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,7-dibromo-4,5,9,10-tetrahydropyrene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12Br2 |
|---|---|
| Molecular Weight | 364.07400 |
| Exact Mass | 361.93100 |
| LogP | 5.07580 |
| InChIKey | DECWZAKGNGDEQE-UHFFFAOYSA-N |
| SMILES | Brc1cc2c3c(c1)CCc1cc(Br)cc(c1-3)CC2 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pyrene,2,7-dibromo-4,5,9,10-tetrahydro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,7-dibromo-4,5,9,10-tetrahydropyrene? |
| A: The English name of 2,7-dibromo-4,5,9,10-tetrahydropyrene is 2,7-dibromo-4,5,9,10-tetrahydropyrene. |
| Q: What is the CAS number of 2,7-dibromo-4,5,9,10-tetrahydropyrene? |
| A: CAS number of 2,7-dibromo-4,5,9,10-tetrahydropyrene is 17533-36-7. |
| Q: What is the LogP of 2,7-dibromo-4,5,9,10-tetrahydropyrene? |
| A: LogP of 2,7-dibromo-4,5,9,10-tetrahydropyrene is 5.07580. |
| Q: What is the SMILES notation of 2,7-dibromo-4,5,9,10-tetrahydropyrene? |
| A: SMILES notation of 2,7-dibromo-4,5,9,10-tetrahydropyrene is Brc1cc2c3c(c1)CCc1cc(Br)cc(c1-3)CC2. |
| Q: What is the molecular weight of 2,7-dibromo-4,5,9,10-tetrahydropyrene? |
| A: Molecular weight of 2,7-dibromo-4,5,9,10-tetrahydropyrene is 364.07400. |
| Q: What is the molecular formula of 2,7-dibromo-4,5,9,10-tetrahydropyrene? |
| A: Molecular formula of 2,7-dibromo-4,5,9,10-tetrahydropyrene is C16H12Br2. |
| Q: What is the InChIKey of 2,7-dibromo-4,5,9,10-tetrahydropyrene? |
| A: InChIKey of 2,7-dibromo-4,5,9,10-tetrahydropyrene is DECWZAKGNGDEQE-UHFFFAOYSA-N. |
| Q: What English synonyms does 2,7-dibromo-4,5,9,10-tetrahydropyrene have? |
| A: English synonyms of 2,7-dibromo-4,5,9,10-tetrahydropyrene: Pyrene,2,7-dibromo-4,5,9,10-tetrahydro. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |