4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine
Modify Date: 2026-06-20 23:59:56
![4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine Structure](https://www.chemsrc.com/extcaspic/302/175357-96-7.png)
4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine structure
|
Common Name | 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 175357-96-7 | Molecular Weight | 316.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10BrN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10BrN5 |
|---|---|
| Molecular Weight | 316.16 |
| InChIKey | TWTYLCVLKNHZDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)NC2=NC=NC3=CN=C(C=C32)N |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 6, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine? |
| A: Molecular formula of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine is C13H10BrN5. |
| Q: What is the English name of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine? |
| A: The English name of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine is 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine. |
| Q: What is the SMILES notation of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine? |
| A: SMILES notation of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine is C1=CC(=CC(=C1)Br)NC2=NC=NC3=CN=C(C=C32)N. |
| Q: What is the CAS number of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine? |
| A: CAS number of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine is 175357-96-7. |
| Q: What is the InChIKey of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine? |
| A: InChIKey of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine is TWTYLCVLKNHZDT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 175357-96-7? |
| A: Chinese name of 175357-96-7 is 175357-96-7. |
| Q: What is the molecular weight of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine? |
| A: Molecular weight of 4-N-(3-bromophenyl)pyrido[3,4-d]pyrimidine-4,6-diamine is 316.16. |