2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl)
Modify Date: 2026-09-26 19:13:46
2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl) structure
|
Common Name | 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl) | ||
|---|---|---|---|---|
| CAS Number | 17537-47-2 | Molecular Weight | 236.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O4 |
|---|---|
| Molecular Weight | 236.26 |
| InChIKey | UNXVAHUGZCMOCO-UHFFFAOYSA-N |
| SMILES | COc1cc(C=C(C)C=O)cc(OC)c1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 17537-47-2? |
| A: Chinese name of 17537-47-2 is 17537-47-2. |
| Q: What is the SMILES notation of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl)? |
| A: SMILES notation of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl) is COc1cc(C=C(C)C=O)cc(OC)c1OC. |
| Q: What is the molecular formula of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl)? |
| A: Molecular formula of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl) is C13H16O4. |
| Q: What is the CAS number of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl)? |
| A: CAS number of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl) is 17537-47-2. |
| Q: What is the InChIKey of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl)? |
| A: InChIKey of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl) is UNXVAHUGZCMOCO-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl)? |
| A: The English name of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl) is 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl). |
| Q: What is the molecular weight of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl)? |
| A: Molecular weight of 2-Propenal, 2-methyl-3-(3,4,5-trimethoxyphenyl) is 236.26. |