ETHYL 4-(3,4-DIMETHYLPHENYL)-4-OXOBUTYRATE
ETHYL 4-(3,4-DIMETHYLPHENYL)-4-OXOBUTYRATE structure
|
Common Name | ETHYL 4-(3,4-DIMETHYLPHENYL)-4-OXOBUTYRATE | ||
|---|---|---|---|---|
| CAS Number | 175394-01-1 | Molecular Weight | 234.29100 | |
| Density | 1.05g/cm3 | Boiling Point | 361.9ºC at 760 mmHg | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.8ºC | |
Summary: Ethyl 4-(3,4-Dimethylphenyl)-4-Oxobutanoate (CAS: 175394-01-1, molecular formula: C14H18O3, molecular weight: 234.29100) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 361.9ºC at 760 mmHg |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29100 |
| Flash Point | 158.8ºC |
| Exact Mass | 234.12600 |
| PSA | 43.37000 |
| LogP | 2.82940 |
| Vapour Pressure | 2E-05mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | UXLMZKLDVOQALH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)c1ccc(C)c(C)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918300090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ETHYL 4-(3,4-DI... CAS#:175394-01-1 |
| Literature: WO2006/82952 A1, ; Page/Page column 223 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:51036-98-7This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 3-(3,4-dimethylbenzoyl)propionate |
| ETHYL 4-(3,4-DIMETHYLPHENYL)-4-OXOBUTYRATE |
| 4-(3,4-dimethylphenyl)-4-oxobutanoic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate? |
| A: CAS number of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate is 175394-01-1. |
| Q: What is the SMILES notation of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate? |
| A: SMILES notation of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate is CCOC(=O)CCC(=O)c1ccc(C)c(C)c1. |
| Q: What is the molecular weight of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate? |
| A: Molecular weight of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate is 234.29100. |
| Q: What is the English name of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate? |
| A: The English name of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate is ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate. |
| Q: What are the downstream products of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate? |
| A: Related downstream products(CAS) of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate: 51036-98-7. |
| Q: What is the Chinese name of 175394-01-1? |
| A: Chinese name of 175394-01-1 is 175394-01-1. |
| Q: What are the upstream materials of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate? |
| A: Related upstream materials(CAS) of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate: 14794-31-1;95-47-6. |
| Q: What is the polar surface area (PSA) of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate? |
| A: Polar surface area (PSA) of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate is 43.37000. |
| Q: What is the boiling point of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate? |
| A: Boiling point of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate is 361.9ºC at 760 mmHg. |
| Q: What is the InChIKey of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate? |
| A: InChIKey of ethyl 4-(3,4-dimethylphenyl)-4-oxobutanoate is UXLMZKLDVOQALH-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |