2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol
Modify Date: 2025-12-01 12:28:08
2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol structure
|
Common Name | 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol | ||
|---|---|---|---|---|
| CAS Number | 17541-02-5 | Molecular Weight | 252.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16O2 |
|---|---|
| Molecular Weight | 252.30800 |
| Exact Mass | 252.11500 |
| PSA | 29.46000 |
| LogP | 3.60130 |
| InChIKey | ZMTLMKNQOGROAB-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C#Cc1ccc(Oc2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol? |
| A: Molecular weight of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol is 252.30800. |
| Q: What is the SMILES notation of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol? |
| A: SMILES notation of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol is CC(C)(O)C#Cc1ccc(Oc2ccccc2)cc1. |
| Q: What is the InChIKey of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol? |
| A: InChIKey of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol is ZMTLMKNQOGROAB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol? |
| A: Molecular formula of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol is C17H16O2. |
| Q: What is the English name of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol? |
| A: The English name of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol is 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol. |
| Q: What is the LogP of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol? |
| A: LogP of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol is 3.60130. |
| Q: What is the polar surface area (PSA) of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol? |
| A: Polar surface area (PSA) of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol is 29.46000. |
| Q: What is the CAS number of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol? |
| A: CAS number of 2-methyl-4-(4-phenoxyphenyl)but-3-yn-2-ol is 17541-02-5. |
| Q: What is the Chinese name of 17541-02-5? |
| A: Chinese name of 17541-02-5 is 17541-02-5. |