(-)-1,2,6,7,8,9,10,11-Octahydro-1,6,6-trimethylphenanthro[1,2-b]furan-10,11-dione
![(-)-1,2,6,7,8,9,10,11-Octahydro-1,6,6-trimethylphenanthro[1,2-b]furan-10,11-dione Structure](https://image.chemsrc.com/caspic/101/17545-07-2.png)
(-)-1,2,6,7,8,9,10,11-Octahydro-1,6,6-trimethylphenanthro[1,2-b]furan-10,11-dione structure
|
Common Name | (-)-1,2,6,7,8,9,10,11-Octahydro-1,6,6-trimethylphenanthro[1,2-b]furan-10,11-dione | ||
|---|---|---|---|---|
| CAS Number | 17545-07-2 | Molecular Weight | 296.360 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 459.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4±28.8 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | SYSU-00437 |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 459.0±45.0 °C at 760 mmHg |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.360 |
| Flash Point | 203.4±28.8 °C |
| Exact Mass | 296.141235 |
| LogP | 4.93 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | GVKKJJOMQCNPGB-UHFFFAOYSA-N |
| SMILES | CC1COC2=C1C(=O)C(=O)c1c2ccc2c1CCCC2(C)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,6,6-Trimethyl-1,2,6,7,8,9-hexahydrophenanthro[1,2-b]furan-10,11-dione |
| SYSU-00437 |
| Cryptotanshinone |
| MFCD07636810 |
| MFCD05671363 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of SYSU-00437? |
| A: The English name of SYSU-00437 is SYSU-00437. |
| Q: What is the CAS number of SYSU-00437? |
| A: CAS number of SYSU-00437 is 17545-07-2. |
| Q: What is the LogP of SYSU-00437? |
| A: LogP of SYSU-00437 is 4.93. |
| Q: What is the SMILES notation of SYSU-00437? |
| A: SMILES notation of SYSU-00437 is CC1COC2=C1C(=O)C(=O)c1c2ccc2c1CCCC2(C)C. |
| Q: What is the InChIKey of SYSU-00437? |
| A: InChIKey of SYSU-00437 is GVKKJJOMQCNPGB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of SYSU-00437? |
| A: Molecular weight of SYSU-00437 is 296.360. |
| Q: What English synonyms does SYSU-00437 have? |
| A: English synonyms of SYSU-00437: 1,6,6-Trimethyl-1,2,6,7,8,9-hexahydrophenanthro[1,2-b]furan-10,11-dione, SYSU-00437, Cryptotanshinone, MFCD07636810, MFCD05671363. |
| Q: What is the Chinese name of 17545-07-2? |
| A: Chinese name of 17545-07-2 is 17545-07-2. |
| Q: What is the boiling point of SYSU-00437? |
| A: Boiling point of SYSU-00437 is 459.0±45.0 °C at 760 mmHg. |
| Q: What is the molecular formula of SYSU-00437? |
| A: Molecular formula of SYSU-00437 is C19H20O3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |