4-Boc-Aminomethyl-3-hydroxy-1-N-Boc-pyrrolidine structure
|
Common Name | 4-Boc-Aminomethyl-3-hydroxy-1-N-Boc-pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 175463-34-0 | Molecular Weight | 316.393 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 437.1±30.0 °C at 760 mmHg | |
| Molecular Formula | C15H28N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.2±24.6 °C | |
| Name | tert-butyl 3-hydroxy-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 437.1±30.0 °C at 760 mmHg |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.393 |
| Flash Point | 218.2±24.6 °C |
| Exact Mass | 316.199829 |
| PSA | 88.10000 |
| LogP | 1.01 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | VSFCEPRNHYOLGU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CN(C(=O)OC(C)(C)C)CC1O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-BOC-AMINOMETHYL-3-HYDROXY-1-BOC-PYRROLIDINE |
| 1-Pyrrolidinecarboxylic acid, 3-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-4-hydroxy-, 1,1-dimethylethyl ester |
| 4-Boc-aminomethyl-3-hydroxy-1-N-Boc-pyrrolidine |
| tert-Butyl 3-{[(tert-butoxycarbonyl)amino]methyl}-4-hydroxypyrrolidine-1-carboxylate |
| 4-Boc-aminomethyl-1-N-Boc-pyrrolidin-3-ol |
| 2-Methyl-2-propanyl 3-hydroxy-4-[({[(2-methyl-2-propanyl)oxy]carbonyl}amino)methyl]-1-pyrrolidinecarboxylate |