1H-Benzimidazole-2-methanamine,5-methoxy-(9CI) structure
|
Common Name | 1H-Benzimidazole-2-methanamine,5-methoxy-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 175530-52-6 | Molecular Weight | 177.20300 | |
| Density | 1.274g/cm3 | Boiling Point | 417ºC at 760 mmHg | |
| Molecular Formula | C9H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206ºC | |
| Name | 1-(6-methoxy-1h-benzimidazol-2-yl)methanamine, 95% |
|---|
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760 mmHg |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.20300 |
| Flash Point | 206ºC |
| Exact Mass | 177.09000 |
| PSA | 63.93000 |
| LogP | 1.73050 |
| Vapour Pressure | 3.66E-07mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | FGNLSJXLMAQALY-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(CN)[nH]c2c1.Cl.Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |