Rifamycin,1,4-dideoxy-1,4-dihydro-3-(methylamino)-1,4-dioxo- (9CI)
Rifamycin,1,4-dideoxy-1,4-dihydro-3-(methylamino)-1,4-dioxo- (9CI) structure
|
Common Name | Rifamycin,1,4-dideoxy-1,4-dihydro-3-(methylamino)-1,4-dioxo- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 17554-98-2 | Molecular Weight | 724.79400 | |
| Density | 1.33g/cm3 | Boiling Point | 943.4ºC at 760mmHg | |
| Molecular Formula | C38H48N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 524.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | nsc267230 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 943.4ºC at 760mmHg |
| Molecular Formula | C38H48N2O12 |
| Molecular Weight | 724.79400 |
| Flash Point | 524.3ºC |
| Exact Mass | 724.32100 |
| PSA | 207.02000 |
| LogP | 3.89710 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | WCGYROKEDWMGAI-FXZGSCNBSA-N |
| SMILES | CNC1=C2NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C(C)C(OC)C=COC3(C)Oc4c(C)c(O)c(c(c4C3=O)C1=O)C2=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:62623-68-1
CAS#:74-89-5This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of nsc267230? |
| A: InChIKey of nsc267230 is WCGYROKEDWMGAI-FXZGSCNBSA-N. |
| Q: What is the Chinese name of 17554-98-2? |
| A: Chinese name of 17554-98-2 is 17554-98-2. |
| Q: What is the English name of nsc267230? |
| A: The English name of nsc267230 is nsc267230. |
| Q: What is the SMILES notation of nsc267230? |
| A: SMILES notation of nsc267230 is CNC1=C2NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C(C)C(OC)C=COC3(C)Oc4c(C)c(O)c(c(c4C3=O)C1=O)C2=O. |
| Q: What is the molecular weight of nsc267230? |
| A: Molecular weight of nsc267230 is 724.79400. |
| Q: What is the molecular formula of nsc267230? |
| A: Molecular formula of nsc267230 is C38H48N2O12. |
| Q: What is the CAS number of nsc267230? |
| A: CAS number of nsc267230 is 17554-98-2. |
| Q: What are the upstream materials of nsc267230? |
| A: Related upstream materials(CAS) of nsc267230: 62623-68-1;74-89-5. |
| Q: What is the boiling point of nsc267230? |
| A: Boiling point of nsc267230 is 943.4ºC at 760mmHg. |
| Q: What is the LogP of nsc267230? |
| A: LogP of nsc267230 is 3.89710. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |