2,1,3-Benzoxadiazole-5-methanol,1-oxide
2,1,3-Benzoxadiazole-5-methanol,1-oxide structure
|
Common Name | 2,1,3-Benzoxadiazole-5-methanol,1-oxide | ||
|---|---|---|---|---|
| CAS Number | 175609-23-1 | Molecular Weight | 166.13400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H6N2O3 |
|---|---|
| Molecular Weight | 166.13400 |
| Exact Mass | 166.03800 |
| PSA | 71.72000 |
| LogP | 0.74860 |
| InChIKey | PGGQDQFDAHJMTE-UHFFFAOYSA-N |
| SMILES | [O-][n+]1onc2cc(CO)ccc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:19164-42-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-hydroxymethylbenzofuroxan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide? |
| A: LogP of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide is 0.74860. |
| Q: What is the InChIKey of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide? |
| A: InChIKey of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide is PGGQDQFDAHJMTE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide? |
| A: Molecular weight of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide is 166.13400. |
| Q: What is the English name of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide? |
| A: The English name of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide is 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide. |
| Q: What is the polar surface area (PSA) of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide? |
| A: Polar surface area (PSA) of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide is 71.72000. |
| Q: What is the CAS number of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide? |
| A: CAS number of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide is 175609-23-1. |
| Q: What is the molecular formula of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide? |
| A: Molecular formula of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide is C7H6N2O3. |
| Q: What is the Chinese name of 175609-23-1? |
| A: Chinese name of 175609-23-1 is 175609-23-1. |
| Q: What English synonyms does 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide have? |
| A: English synonyms of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide: 5-hydroxymethylbenzofuroxan. |
| Q: What is the SMILES notation of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide? |
| A: SMILES notation of 5-(hydroxymethyl)benzo[1,2-c]1,2,5-oxadiazole N1-oxide is [O-][n+]1onc2cc(CO)ccc21. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |