(3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane)
(3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) structure
|
Common Name | (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) | ||
|---|---|---|---|---|
| CAS Number | 175658-90-9 | Molecular Weight | 386.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18Br2SSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18Br2SSi2 |
|---|---|
| Molecular Weight | 386.29400 |
| Exact Mass | 383.90300 |
| PSA | 28.24000 |
| LogP | 4.36350 |
| InChIKey | QWUMEYRROFOWMV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1sc([Si](C)(C)C)c(Br)c1Br |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~83%
(3,4-Dibromo-2,... CAS#:175658-90-9 |
| Literature: Advanced Synthesis and Catalysis, , vol. 351, # 10 p. 1595 - 1609 |
|
~45%
(3,4-Dibromo-2,... CAS#:175658-90-9 |
| Literature: Tetrahedron Letters, , vol. 42, # 10 p. 2039 - 2041 |
|
~99%
(3,4-Dibromo-2,... CAS#:175658-90-9 |
| Literature: Letters in Organic Chemistry, , vol. 6, # 6 p. 474 - 477 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2-Dibrom-3,3-dimethyl-butan |
| 3,4-dibromo-2,5-bis-trimethylsilanyl-thiophene |
| 2,5-ditrimethylsilyl-3,4-dibromothiophene |
| Pseudobutylaethylendibromid |
| Butane,1,2-dibromo-3,3-dimethyl |
| 3,4-dibromo-2,2-dimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 175658-90-9? |
| A: Chinese name of 175658-90-9 is 175658-90-9. |
| Q: What is the CAS number of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane)? |
| A: CAS number of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) is 175658-90-9. |
| Q: What is the SMILES notation of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane)? |
| A: SMILES notation of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) is C[Si](C)(C)c1sc([Si](C)(C)C)c(Br)c1Br. |
| Q: What English synonyms does (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) have? |
| A: English synonyms of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane): 1,2-Dibrom-3,3-dimethyl-butan, 3,4-dibromo-2,5-bis-trimethylsilanyl-thiophene, 2,5-ditrimethylsilyl-3,4-dibromothiophene, Pseudobutylaethylendibromid, Butane,1,2-dibromo-3,3-dimethyl, 3,4-dibromo-2,2-dimethyl. |
| Q: What is the molecular weight of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane)? |
| A: Molecular weight of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) is 386.29400. |
| Q: What is the molecular formula of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane)? |
| A: Molecular formula of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) is C10H18Br2SSi2. |
| Q: What is the polar surface area (PSA) of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane)? |
| A: Polar surface area (PSA) of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) is 28.24000. |
| Q: What is the LogP of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane)? |
| A: LogP of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) is 4.36350. |
| Q: What is the English name of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane)? |
| A: The English name of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) is (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane). |
| Q: What is the InChIKey of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane)? |
| A: InChIKey of (3,4-Dibromo-2,5-thienediyl)bis(trimethylsilane) is QWUMEYRROFOWMV-UHFFFAOYSA-N. |