(1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one
Modify Date: 2025-08-27 18:17:44
![(1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one Structure](https://www.chemsrc.com/extcaspic/207/175671-41-7.png)
(1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one structure
|
Common Name | (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one | ||
|---|---|---|---|---|
| CAS Number | 175671-41-7 | Molecular Weight | 231.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17NO2 |
|---|---|
| Molecular Weight | 231.29 |
| InChIKey | WJAONTKZWYIENP-WCFLWFBJSA-N |
| SMILES | CC(c1ccccc1)N1CCC2CC1C(=O)O2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 175671-41-7? |
| A: Chinese name of 175671-41-7 is 175671-41-7. |
| Q: What is the English name of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one? |
| A: The English name of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one is (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one. |
| Q: What is the CAS number of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one? |
| A: CAS number of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one is 175671-41-7. |
| Q: What is the molecular weight of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one? |
| A: Molecular weight of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one is 231.29. |
| Q: What is the InChIKey of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one? |
| A: InChIKey of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one is WJAONTKZWYIENP-WCFLWFBJSA-N. |
| Q: What is the SMILES notation of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one? |
| A: SMILES notation of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one is CC(c1ccccc1)N1CCC2CC1C(=O)O2. |
| Q: What is the molecular formula of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one? |
| A: Molecular formula of (1R,5S)-2-[(1S)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one is C14H17NO2. |