1,4- DIHYDRO-2,6-DIMETHYL-3-(2-CYANOETHOXYCARBONYL)-5-ETHOXYCARBONYL-4-(2,3-DICHLOROPHENYL)PYRIDINE
1,4- DIHYDRO-2,6-DIMETHYL-3-(2-CYANOETHOXYCARBONYL)-5-ETHOXYCARBONYL-4-(2,3-DICHLOROPHENYL)PYRIDINE structure
|
Common Name | 1,4- DIHYDRO-2,6-DIMETHYL-3-(2-CYANOETHOXYCARBONYL)-5-ETHOXYCARBONYL-4-(2,3-DICHLOROPHENYL)PYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 175688-78-5 | Molecular Weight | 423.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20Cl2N2O4 |
|---|---|
| Molecular Weight | 423.29000 |
| Exact Mass | 422.08000 |
| PSA | 88.42000 |
| LogP | 4.57698 |
| InChIKey | RZOPKQWAEXIRCY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCC#N)C1c1cccc(Cl)c1Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:72509-76-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: CAS number of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 175688-78-5. |
| Q: What is the LogP of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: LogP of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 4.57698. |
| Q: What is the InChIKey of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: InChIKey of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is RZOPKQWAEXIRCY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: Molecular formula of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is C20H20Cl2N2O4. |
| Q: What is the polar surface area (PSA) of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: Polar surface area (PSA) of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 88.42000. |
| Q: What are the downstream products of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: Related downstream products(CAS) of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate: 72509-76-3. |
| Q: What is the English name of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: The English name of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. |
| Q: What is the Chinese name of 175688-78-5? |
| A: Chinese name of 175688-78-5 is 175688-78-5. |
| Q: What is the molecular weight of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: Molecular weight of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 423.29000. |
| Q: What is the SMILES notation of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: SMILES notation of 5-O-(2-cyanoethyl) 3-O-ethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCC#N)C1c1cccc(Cl)c1Cl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |