Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate
Modify Date: 2026-07-24 18:46:47
Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate structure
|
Common Name | Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 175694-38-9 | Molecular Weight | 201.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H15NO4 |
|---|---|
| Molecular Weight | 201.22 |
| InChIKey | FOEXRJBHOCBGFH-KNVOCYPGSA-N |
| SMILES | COC(=O)C1CNCC(C(=O)OC)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate? |
| A: CAS number of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate is 175694-38-9. |
| Q: What is the molecular formula of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate? |
| A: Molecular formula of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate is C9H15NO4. |
| Q: What is the molecular weight of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate? |
| A: Molecular weight of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate is 201.22. |
| Q: What is the SMILES notation of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate? |
| A: SMILES notation of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate is COC(=O)C1CNCC(C(=O)OC)C1. |
| Q: What is the English name of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate? |
| A: The English name of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate is Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate. |
| Q: What is the InChIKey of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate? |
| A: InChIKey of Rel-dimethyl (3S,5R)-piperidine-3,5-dicarboxylate is FOEXRJBHOCBGFH-KNVOCYPGSA-N. |
| Q: What is the Chinese name of 175694-38-9? |
| A: Chinese name of 175694-38-9 is 175694-38-9. |