(E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin)
Modify Date: 2026-07-08 17:34:04
(E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin) structure
|
Common Name | (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin) | ||
|---|---|---|---|---|
| CAS Number | 175702-01-9 | Molecular Weight | 642.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H34N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C38H34N4O6 |
|---|---|
| Molecular Weight | 642.7 |
| InChIKey | OIUNULHHOJRJBI-IAGONARPSA-N |
| SMILES | O=C(C=Cc1ccc(O)cc1)NCCc1c[nH]c2ccc(O)c(-c3c(O)ccc4[nH]cc(CCNC(=O)C=Cc5ccc(O)cc5)c34)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin)? |
| A: InChIKey of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin) is OIUNULHHOJRJBI-IAGONARPSA-N. |
| Q: What is the English name of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin)? |
| A: The English name of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin) is (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin). |
| Q: What is the CAS number of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin)? |
| A: CAS number of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin) is 175702-01-9. |
| Q: What is the molecular formula of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin)? |
| A: Molecular formula of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin) is C38H34N4O6. |
| Q: What is the Chinese name of 175702-01-9? |
| A: Chinese name of 175702-01-9 is 175702-01-9. |
| Q: What is the molecular weight of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin)? |
| A: Molecular weight of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin) is 642.7. |
| Q: What is the SMILES notation of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin)? |
| A: SMILES notation of (E,E)-4,4''-Bi(N-4-hydroxycinnamoylserotonin) is O=C(C=Cc1ccc(O)cc1)NCCc1c[nH]c2ccc(O)c(-c3c(O)ccc4[nH]cc(CCNC(=O)C=Cc5ccc(O)cc5)c34)c12. |