Methyl-4-(2,4-dichlorphenyl)-2,4-dioxobutanoat structure
|
Common Name | Methyl-4-(2,4-dichlorphenyl)-2,4-dioxobutanoat | ||
|---|---|---|---|---|
| CAS Number | 175711-73-6 | Molecular Weight | 275.085 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 386.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C11H8Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.0±24.1 °C | |
| Name | methyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 386.2±32.0 °C at 760 mmHg |
| Molecular Formula | C11H8Cl2O4 |
| Molecular Weight | 275.085 |
| Flash Point | 162.0±24.1 °C |
| Exact Mass | 273.979950 |
| PSA | 60.44000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | AANFKOMMZYTNJZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)c1ccc(Cl)cc1Cl |
| HS Code | 2918300090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzenebutanoic acid, 2,4-dichloro-α,γ-dioxo-, methyl ester |
| Methyl-4-(2,4-dichlorphenyl)-2,4-dioxobutanoat |
| Methyl 2,4-dichloro-a,g-dioxo-benzenebutanoate |
| Methyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate |