4,6-Nonanedione, 2,2,8,8-tetramethyl structure
|
Common Name | 4,6-Nonanedione, 2,2,8,8-tetramethyl | ||
|---|---|---|---|---|
| CAS Number | 17575-03-0 | Molecular Weight | 212.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-Nonanedione, 2,2,8,8-tetramethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H24O2 |
|---|---|
| Molecular Weight | 212.33 |
| InChIKey | XWXZPFGJVHAMGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)CC(=O)CC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4,6-Nonanedione, 2,2,8,8-tetramethyl? |
| A: SMILES notation of 4,6-Nonanedione, 2,2,8,8-tetramethyl is CC(C)(C)CC(=O)CC(=O)CC(C)(C)C. |
| Q: What is the molecular formula of 4,6-Nonanedione, 2,2,8,8-tetramethyl? |
| A: Molecular formula of 4,6-Nonanedione, 2,2,8,8-tetramethyl is C13H24O2. |
| Q: What is the Chinese name of 17575-03-0? |
| A: Chinese name of 17575-03-0 is 17575-03-0. |
| Q: What is the English name of 4,6-Nonanedione, 2,2,8,8-tetramethyl? |
| A: The English name of 4,6-Nonanedione, 2,2,8,8-tetramethyl is 4,6-Nonanedione, 2,2,8,8-tetramethyl. |
| Q: What is the InChIKey of 4,6-Nonanedione, 2,2,8,8-tetramethyl? |
| A: InChIKey of 4,6-Nonanedione, 2,2,8,8-tetramethyl is XWXZPFGJVHAMGS-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4,6-Nonanedione, 2,2,8,8-tetramethyl? |
| A: CAS number of 4,6-Nonanedione, 2,2,8,8-tetramethyl is 17575-03-0. |
| Q: What is the molecular weight of 4,6-Nonanedione, 2,2,8,8-tetramethyl? |
| A: Molecular weight of 4,6-Nonanedione, 2,2,8,8-tetramethyl is 212.33. |