Card-20(22)-enolide,3-[(O-b-D-glucopyranosyl-(1®4)-O-3-O-acetyl-2,6-dideoxy-b-D-ribo-hexopyranosyl-(1®4)-O-2,6-dideoxy-b-D-ribo-hexopyranosyl-(1®4)-2,6-dideoxy-b-D-ribo-hexopyranosyl)oxy] structure
|
Common Name | Card-20(22)-enolide,3-[(O-b-D-glucopyranosyl-(1®4)-O-3-O-acetyl-2,6-dideoxy-b-D-ribo-hexopyranosyl-(1®4)-O-2,6-dideoxy-b-D-ribo-hexopyranosyl-(1®4)-2,6-dideoxy-b-D-ribo-hexopyranosyl)oxy] | ||
|---|---|---|---|---|
| CAS Number | 17575-20-1 | Molecular Weight | 969.11600 | |
| Density | 1.39g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C49H76O19 | Melting Point | 245-248ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | lanatoside a |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.39g/cm3 |
|---|---|
| Melting Point | 245-248ºC |
| Molecular Formula | C49H76O19 |
| Molecular Weight | 969.11600 |
| Exact Mass | 968.49800 |
| PSA | 268.05000 |
| LogP | 1.64230 |
| Index of Refraction | 1.601 |
| InChIKey | YFGQJKBUXPKSAW-YSTAXILLSA-N |
| SMILES | CC(=O)OC1CC(OC2C(O)CC(OC3C(O)CC(OC4CCC5(C)C(CCC6C5CCC5(C)C(C7=CC(=O)OC7)CCC65O)C4)OC3C)OC2C)OC(C)C1OC1OC(CO)C(O)C(O)C1O |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| digitoxigenin+2digitoxose+acetyl-digilanidobose |
| digilanida |
| Lanatosid A |
| Digitoxigenin 3-O-bisdigitoxosideacetyldigilanidobioside,or lanatoside A |
| DIGILANIDE A |
| adigal |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of lanatoside a? |
| A: Molecular weight of lanatoside a is 969.11600. |
| Q: What is the molecular formula of lanatoside a? |
| A: Molecular formula of lanatoside a is C49H76O19. |
| Q: What is the LogP of lanatoside a? |
| A: LogP of lanatoside a is 1.64230. |
| Q: What is the InChIKey of lanatoside a? |
| A: InChIKey of lanatoside a is YFGQJKBUXPKSAW-YSTAXILLSA-N. |
| Q: What is the English name of lanatoside a? |
| A: The English name of lanatoside a is lanatoside a. |
| Q: What is the polar surface area (PSA) of lanatoside a? |
| A: Polar surface area (PSA) of lanatoside a is 268.05000. |
| Q: What English synonyms does lanatoside a have? |
| A: English synonyms of lanatoside a: digitoxigenin+2digitoxose+acetyl-digilanidobose, digilanida, Lanatosid A, Digitoxigenin 3-O-bisdigitoxosideacetyldigilanidobioside,or lanatoside A, DIGILANIDE A, adigal. |
| Q: What is the SMILES notation of lanatoside a? |
| A: SMILES notation of lanatoside a is CC(=O)OC1CC(OC2C(O)CC(OC3C(O)CC(OC4CCC5(C)C(CCC6C5CCC5(C)C(C7=CC(=O)OC7)CCC65O)C4)OC3C)OC2C)OC(C)C1OC1OC(CO)C(O)C(O)C1O. |
| Q: What are the downstream products of lanatoside a? |
| A: Related downstream products(CAS) of lanatoside a: 1102-88-1;527-52-6;143-62-4;2280-44-6;71-63-6. |
| Q: What is the melting point of lanatoside a? |
| A: Melting point of lanatoside a is 245-248ºC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |