(3R)-3-ethyl-3-phenylpiperidine-2,6-dione
Modify Date: 2026-07-06 16:34:58
(3R)-3-ethyl-3-phenylpiperidine-2,6-dione structure
|
Common Name | (3R)-3-ethyl-3-phenylpiperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 17575-58-5 | Molecular Weight | 217.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3R)-3-ethyl-3-phenylpiperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15NO2 |
|---|---|
| Molecular Weight | 217.26400 |
| Exact Mass | 217.11000 |
| PSA | 49.66000 |
| LogP | 2.04690 |
| InChIKey | JMBQKKAJIKAWKF-CYBMUJFWSA-N |
| SMILES | CCC1(c2ccccc2)CCC(=O)NC1=O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-ethyl-3-phenylglutarimide |
| 3-ethyl-3-phenyl-piperidine-2,6-dione |
| 3-phenyl-3-ethylpiperidine-2,6-dione |
| Glutethimide |
| 3-ethyl-3-phenyl-2,6-piperidinedione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione? |
| A: Molecular formula of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione is C13H15NO2. |
| Q: What English synonyms does (3R)-3-ethyl-3-phenylpiperidine-2,6-dione have? |
| A: English synonyms of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione: 3-ethyl-3-phenylglutarimide, 3-ethyl-3-phenyl-piperidine-2,6-dione, 3-phenyl-3-ethylpiperidine-2,6-dione, Glutethimide, 3-ethyl-3-phenyl-2,6-piperidinedione. |
| Q: What is the CAS number of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione? |
| A: CAS number of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione is 17575-58-5. |
| Q: What is the Chinese name of 17575-58-5? |
| A: Chinese name of 17575-58-5 is 17575-58-5. |
| Q: What is the InChIKey of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione? |
| A: InChIKey of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione is JMBQKKAJIKAWKF-CYBMUJFWSA-N. |
| Q: What is the SMILES notation of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione? |
| A: SMILES notation of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione is CCC1(c2ccccc2)CCC(=O)NC1=O. |
| Q: What is the molecular weight of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione? |
| A: Molecular weight of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione is 217.26400. |
| Q: What is the English name of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione? |
| A: The English name of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione is (3R)-3-ethyl-3-phenylpiperidine-2,6-dione. |
| Q: What is the polar surface area (PSA) of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione? |
| A: Polar surface area (PSA) of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione is 49.66000. |
| Q: What is the LogP of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione? |
| A: LogP of (3R)-3-ethyl-3-phenylpiperidine-2,6-dione is 2.04690. |