(-)-Glutethimide
Modify Date: 2025-10-24 07:30:18
(-)-Glutethimide structure
|
Common Name | (-)-Glutethimide | ||
|---|---|---|---|---|
| CAS Number | 17575-59-6 | Molecular Weight | 217.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (-)-Glutethimide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15NO2 |
|---|---|
| Molecular Weight | 217.26 |
| InChIKey | JMBQKKAJIKAWKF-ZDUSSCGKSA-N |
| SMILES | CCC1(c2ccccc2)CCC(=O)NC1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 17575-59-6? |
| A: Chinese name of 17575-59-6 is 17575-59-6. |
| Q: What is the molecular weight of (-)-Glutethimide? |
| A: Molecular weight of (-)-Glutethimide is 217.26. |
| Q: What is the English name of (-)-Glutethimide? |
| A: The English name of (-)-Glutethimide is (-)-Glutethimide. |
| Q: What is the molecular formula of (-)-Glutethimide? |
| A: Molecular formula of (-)-Glutethimide is C13H15NO2. |
| Q: What is the CAS number of (-)-Glutethimide? |
| A: CAS number of (-)-Glutethimide is 17575-59-6. |
| Q: What is the SMILES notation of (-)-Glutethimide? |
| A: SMILES notation of (-)-Glutethimide is CCC1(c2ccccc2)CCC(=O)NC1=O. |
| Q: What is the InChIKey of (-)-Glutethimide? |
| A: InChIKey of (-)-Glutethimide is JMBQKKAJIKAWKF-ZDUSSCGKSA-N. |