bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] hydrogen phosphate structure
|
Common Name | bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] hydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 1758-45-8 | Molecular Weight | 474.61200 | |
| Density | 1.048g/cm3 | Boiling Point | 538.7ºC at 760 mmHg | |
| Molecular Formula | C28H43O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.6ºC | |
| Name | bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.048g/cm3 |
|---|---|
| Boiling Point | 538.7ºC at 760 mmHg |
| Molecular Formula | C28H43O4P |
| Molecular Weight | 474.61200 |
| Flash Point | 279.6ºC |
| Exact Mass | 474.29000 |
| PSA | 65.57000 |
| LogP | 8.67240 |
| Vapour Pressure | 1.94E-12mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | CJMDDRXHXPXLMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OP(=O)(O)Oc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| einecs 217-152-0 |