3-chloro-1-(4-phenylphenyl)propan-1-one structure
|
Common Name | 3-chloro-1-(4-phenylphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 17580-20-0 | Molecular Weight | 244.71600 | |
| Density | 1.142g/cm3 | Boiling Point | 390.7ºC at 760 mmHg | |
| Molecular Formula | C15H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.4ºC | |
| Name | 1-Chlor-2-(p-phenylbenzoyl)ethan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 390.7ºC at 760 mmHg |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.71600 |
| Flash Point | 216.4ºC |
| Exact Mass | 244.06500 |
| PSA | 17.07000 |
| LogP | 4.16520 |
| Vapour Pressure | 2.61E-06mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | WOWJDSIOZZVYNR-UHFFFAOYSA-N |
| SMILES | O=C(CCCl)c1ccc(-c2ccccc2)cc1 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-biphenyl-4-yl-2-valeryloxy-ethanone |
| 3-Chlor-4'-phenyl-propiophenon |
| 1-Biphenyl-4-yl-3-chlor-propan-1-on |
| 1-Biphenyl-4-yl-2-valeryloxy-aethanon |
| 4-(3-chloropropionyl)-biphenyl |
| 1-biphenyl-4-yl-3-chloro-propan-1-one |
| Valeriansaeure-4-phenyl-phenacylester |