1,3,3,4,4,5,5-Heptafluoro-2-methoxy-1-cyclopentene structure
|
Common Name | 1,3,3,4,4,5,5-Heptafluoro-2-methoxy-1-cyclopentene | ||
|---|---|---|---|---|
| CAS Number | 1759-60-0 | Molecular Weight | 224.07600 | |
| Density | 1.52g/cm3 | Boiling Point | 102.7ºC at 760 mmHg | |
| Molecular Formula | C6H3F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 21.3ºC | |
| Name | 1,3,3,4,4,5,5-heptafluoro-2-methoxycyclopentene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 102.7ºC at 760 mmHg |
| Molecular Formula | C6H3F7O |
| Molecular Weight | 224.07600 |
| Flash Point | 21.3ºC |
| Exact Mass | 224.00700 |
| PSA | 9.23000 |
| LogP | 2.73340 |
| Vapour Pressure | 38.6mmHg at 25°C |
| Index of Refraction | 1.329 |
| InChIKey | HCVGDVYOISIYKY-UHFFFAOYSA-N |
| SMILES | COC1=C(F)C(F)(F)C(F)(F)C1(F)F |
| HS Code | 2909209000 |
|---|
| HS Code | 2909209000 |
|---|---|
| Summary | 2909209000 other cyclanic, cyclenic or cyclotherpenic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Cyclopentene,1-methoxyheptafluoro |
| 1-methoxyheptafluorocyclopentene |
| 1-Methoxyheptafluor-1-cyclopenten |
| Heptafluor-1-methoxy-cyclopenten |
| 1-Methoxyheptafluorcyclopenten |
| 1,3,3,4,4,5,5-heptafluoro-2-methoxy-cyclopentene |
| Monomethoxyheptafluorocyclopentene |