Tri-p-tolylindium
Modify Date: 2026-07-08 07:16:44
Tri-p-tolylindium structure
|
Common Name | Tri-p-tolylindium | ||
|---|---|---|---|---|
| CAS Number | 17592-22-2 | Molecular Weight | 388.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21In | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tri-p-tolylindium |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H21In |
|---|---|
| Molecular Weight | 388.2 |
| InChIKey | XOHYXKUOSMZKAI-UHFFFAOYSA-N |
| SMILES | Cc1ccc([In](c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Tri-p-tolylindium? |
| A: The English name of Tri-p-tolylindium is Tri-p-tolylindium. |
| Q: What is the molecular formula of Tri-p-tolylindium? |
| A: Molecular formula of Tri-p-tolylindium is C21H21In. |
| Q: What is the SMILES notation of Tri-p-tolylindium? |
| A: SMILES notation of Tri-p-tolylindium is Cc1ccc([In](c2ccc(C)cc2)c2ccc(C)cc2)cc1. |
| Q: What is the molecular weight of Tri-p-tolylindium? |
| A: Molecular weight of Tri-p-tolylindium is 388.2. |
| Q: What is the InChIKey of Tri-p-tolylindium? |
| A: InChIKey of Tri-p-tolylindium is XOHYXKUOSMZKAI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 17592-22-2? |
| A: Chinese name of 17592-22-2 is 17592-22-2. |
| Q: What is the CAS number of Tri-p-tolylindium? |
| A: CAS number of Tri-p-tolylindium is 17592-22-2. |