diphenylmethyleneaminotrimethylsilane
diphenylmethyleneaminotrimethylsilane structure
|
Common Name | diphenylmethyleneaminotrimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 17599-59-6 | Molecular Weight | 253.41400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Diphenylmethyleneaminotrimethylsilane, Chinese name 二苯甲酰氨基三甲基硅烷, CAS number 17599-59-6, molecular formula C16H19NSi, molecular weight 253.41400, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diphenylmethyleneaminotrimethylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19NSi |
|---|---|
| Molecular Weight | 253.41400 |
| Exact Mass | 253.12900 |
| PSA | 12.36000 |
| LogP | 4.35890 |
| InChIKey | SAUFGTFVJAVCAY-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N=C(c1ccccc1)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 7 | |
CAS#:91-00-9
CAS#:420-56-4![Dimesityl[(diphenylmethylene)amino]borane structure](https://image.chemsrc.com/caspic/445/23115-37-9.png)
CAS#:23115-37-9
CAS#:25290-49-7
CAS#:5319-67-5
CAS#:1585-45-1
CAS#:113613-44-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-trimethylsilylbenzophenonimine |
| Diphenylmethylenaminotrimethylsilan |
| N-Trimethylsilyl-benzophenon-imin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does diphenylmethyleneaminotrimethylsilane have? |
| A: English synonyms of diphenylmethyleneaminotrimethylsilane: N-trimethylsilylbenzophenonimine, Diphenylmethylenaminotrimethylsilan, N-Trimethylsilyl-benzophenon-imin. |
| Q: What is the Chinese name of 17599-59-6? |
| A: Chinese name of 17599-59-6 is 17599-59-6. |
| Q: What is the polar surface area (PSA) of diphenylmethyleneaminotrimethylsilane? |
| A: Polar surface area (PSA) of diphenylmethyleneaminotrimethylsilane is 12.36000. |
| Q: What is the molecular weight of diphenylmethyleneaminotrimethylsilane? |
| A: Molecular weight of diphenylmethyleneaminotrimethylsilane is 253.41400. |
| Q: What is the English name of diphenylmethyleneaminotrimethylsilane? |
| A: The English name of diphenylmethyleneaminotrimethylsilane is diphenylmethyleneaminotrimethylsilane. |
| Q: What is the LogP of diphenylmethyleneaminotrimethylsilane? |
| A: LogP of diphenylmethyleneaminotrimethylsilane is 4.35890. |
| Q: What is the molecular formula of diphenylmethyleneaminotrimethylsilane? |
| A: Molecular formula of diphenylmethyleneaminotrimethylsilane is C16H19NSi. |
| Q: What is the InChIKey of diphenylmethyleneaminotrimethylsilane? |
| A: InChIKey of diphenylmethyleneaminotrimethylsilane is SAUFGTFVJAVCAY-UHFFFAOYSA-N. |
| Q: What are the downstream products of diphenylmethyleneaminotrimethylsilane? |
| A: Related downstream products(CAS) of diphenylmethyleneaminotrimethylsilane: 91-00-9;420-56-4;23115-37-9;25290-49-7;5319-67-5;1585-45-1;113613-44-8. |
| Q: What is the CAS number of diphenylmethyleneaminotrimethylsilane? |
| A: CAS number of diphenylmethyleneaminotrimethylsilane is 17599-59-6. |