Ceratinamine
Modify Date: 2026-06-20 19:44:59
Ceratinamine structure
|
Common Name | Ceratinamine | ||
|---|---|---|---|---|
| CAS Number | 175993-07-4 | Molecular Weight | 405.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15Br2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ceratinamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15Br2N3O2 |
|---|---|
| Molecular Weight | 405.08 |
| InChIKey | VLXGYEMZRIGDRH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)OCCCNC(=O)C#N)Br)CCN |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 11, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Ceratinamine? |
| A: SMILES notation of Ceratinamine is C1=C(C=C(C(=C1Br)OCCCNC(=O)C#N)Br)CCN. |
| Q: What is the CAS number of Ceratinamine? |
| A: CAS number of Ceratinamine is 175993-07-4. |
| Q: What is the Chinese name of 175993-07-4? |
| A: Chinese name of 175993-07-4 is 175993-07-4. |
| Q: What is the InChIKey of Ceratinamine? |
| A: InChIKey of Ceratinamine is VLXGYEMZRIGDRH-UHFFFAOYSA-N. |
| Q: What is the English name of Ceratinamine? |
| A: The English name of Ceratinamine is Ceratinamine. |
| Q: What is the molecular weight of Ceratinamine? |
| A: Molecular weight of Ceratinamine is 405.08. |
| Q: What is the molecular formula of Ceratinamine? |
| A: Molecular formula of Ceratinamine is C13H15Br2N3O2. |