3-bromo-1-[4-(3-bromo-2,2-dimethyl-propanoyl)piperazin-1-yl]-2,2-dimethyl-propan-1-one structure
|
Common Name | 3-bromo-1-[4-(3-bromo-2,2-dimethyl-propanoyl)piperazin-1-yl]-2,2-dimethyl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 1760-15-2 | Molecular Weight | 412.16100 | |
| Density | 1.49g/cm3 | Boiling Point | 493.8ºC at 760 mmHg | |
| Molecular Formula | C14H24Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.4ºC | |
| Name | 3-bromo-1-[4-(3-bromo-2,2-dimethylpropanoyl)piperazin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 493.8ºC at 760 mmHg |
| Molecular Formula | C14H24Br2N2O2 |
| Molecular Weight | 412.16100 |
| Flash Point | 252.4ºC |
| Exact Mass | 410.02000 |
| PSA | 40.62000 |
| LogP | 2.37520 |
| Vapour Pressure | 6.82E-10mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | YOIJEGPUCWNOAV-UHFFFAOYSA-N |
| SMILES | CC(C)(CBr)C(=O)N1CCN(C(=O)C(C)(C)CBr)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1'-piperazine-1,4-diylbis(3-bromo-2,2-dimethylpropan-1-one) |