4-Chloro-2-methyl-6-nitro-phenol structure
|
Common Name | 4-Chloro-2-methyl-6-nitro-phenol | ||
|---|---|---|---|---|
| CAS Number | 1760-71-0 | Molecular Weight | 187.580 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 264.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.9±25.9 °C | |
| Name | 4-chloro-2-methyl-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 264.8±35.0 °C at 760 mmHg |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.580 |
| Flash Point | 113.9±25.9 °C |
| Exact Mass | 187.003616 |
| PSA | 66.05000 |
| LogP | 3.21 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | AQCYSHAXKXQEFZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)cc([N+](=O)[O-])c1O |
| HS Code | 2908999090 |
|---|
|
~89%
4-Chloro-2-meth... CAS#:1760-71-0 |
| Literature: Gao, Mingzhang; Wang, Min; Hutchins, Gary D.; Zheng, Qi-Huang European Journal of Medicinal Chemistry, 2008 , vol. 43, # 7 p. 1570 - 1574 |
|
~20%
4-Chloro-2-meth... CAS#:1760-71-0 |
| Literature: Clewley, Robin G.; Cross, Gordon G.; Fischer, Alfred; Henderson, George N. Tetrahedron, 1989 , vol. 45, # 5 p. 1299 - 1310 |
|
~%
4-Chloro-2-meth... CAS#:1760-71-0 |
| Literature: Bures Chemicke Listy, vol. 21, p. 161 Chem. Zentralbl., 1927 , vol. 98, # II p. 1344 |
|
~%
4-Chloro-2-meth... CAS#:1760-71-0 |
| Literature: Deorha,D.S.; Sareen,S.P. Journal of the Indian Chemical Society, 1964 , vol. 41, # 12 p. 837 - 840 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| WNR BQ EG C1 |
| 4-Chloro-2-methyl-6-nitro-phenol |
| 5-Chlor-3-nitro-2-oxy-toluol |
| 4-Chloro-2-methyl-6-nitrophenol |
| EINECS 217-165-1 |
| AQCYSHAXKXQEFZ-UHFFFAOYSA |
| 4-chloro-6-nitro-o-cresol |
| Phenol, 4-chloro-2-methyl-6-nitro- |
| 4-Chlor-6-nitro-o-kresol |
| 4-Chlor-2-methyl-6-nitro-phenol |