Bicyclo[3.1.0]hexane-2,6-dicarboxylic acid, 2-amino-, (1R,2R,5S,6R)-rel- (9CI) structure
|
Common Name | Bicyclo[3.1.0]hexane-2,6-dicarboxylic acid, 2-amino-, (1R,2R,5S,6R)-rel- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 176027-90-0 | Molecular Weight | 185.18 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 376.4±32.0 °C at 760 mmHg | |
| Molecular Formula | C8H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4±25.1 °C | |
Use of Bicyclo[3.1.0]hexane-2,6-dicarboxylic acid, 2-amino-, (1R,2R,5S,6R)-rel- (9CI)(rel)-Eglumegad ((rel)-LY354740) is the racemic isomer of Eglumegad (HY-18941). Eglumegad is a highly potent and selective group II (mGlu2/3) receptor agonist with EC50s of 5 and 24 nM for transfected human mGlu2 and mGlu3 receptors, respectively[1]. |
| Name | Eglumetad |
|---|---|
| Synonym | More Synonyms |
| Description | (rel)-Eglumegad ((rel)-LY354740) is the racemic isomer of Eglumegad (HY-18941). Eglumegad is a highly potent and selective group II (mGlu2/3) receptor agonist with EC50s of 5 and 24 nM for transfected human mGlu2 and mGlu3 receptors, respectively[1]. |
|---|---|
| Related Catalog | |
| Target |
mGluR2[1] |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.4±32.0 °C at 760 mmHg |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 |
| Flash Point | 181.4±25.1 °C |
| Exact Mass | 185.068802 |
| LogP | -1.22 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | VTAARTQTOOYTES-UHFFFAOYSA-N |
| SMILES | NC1(C(=O)O)CCC2C(C(=O)O)C21 |
| 8244 |
| LY354740 |
| MFCD04113018 |
| UNII-ONU5A67T2S |
| ONU5A67T2S |
| (+)-2-Aminobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| l-nebivolol |
| Eglumegad |
| Eglumetad |
| (1S,2S,5R,6S)-2-Amino-bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| Bicyclo[3.1.0]hexane-2,6-dicarboxylic acid, 2-amino-, (1S,2S,5R,6S)- |
| (1S,2S,5R,6S)-2-Aminobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |