4-Pyridinol, 3,5-dichloro-2-methoxy-6-(trichloromethyl)- structure
|
Common Name | 4-Pyridinol, 3,5-dichloro-2-methoxy-6-(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 176046-79-0 | Molecular Weight | 311.37700 | |
| Density | 1.71g/cm3 | Boiling Point | 341.4ºC at 760mmHg | |
| Molecular Formula | C7H4Cl5NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.3ºC | |
| Name | 3,5-dichloro-2-methoxy-6-(trichloromethyl)-1H-pyridin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.71g/cm3 |
|---|---|
| Boiling Point | 341.4ºC at 760mmHg |
| Molecular Formula | C7H4Cl5NO2 |
| Molecular Weight | 311.37700 |
| Flash Point | 160.3ºC |
| Exact Mass | 308.86800 |
| PSA | 42.35000 |
| LogP | 3.92930 |
| Vapour Pressure | 8.06E-05mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | GUYGGZGIKZIRFO-UHFFFAOYSA-N |
| SMILES | COc1[nH]c(C(Cl)(Cl)Cl)c(Cl)c(=O)c1Cl |
|
~51%
4-Pyridinol, 3,... CAS#:176046-79-0 |
| Literature: Tiwari, Anita; Riordan, James M.; Waud, William R.; Struck, Robert F. Journal of Medicinal Chemistry, 2002 , vol. 45, # 5 p. 1079 - 1085 |
|
~%
4-Pyridinol, 3,... CAS#:176046-79-0 |
| Literature: Tiwari, Anita; Riordan, James M.; Waud, William R.; Struck, Robert F. Journal of Medicinal Chemistry, 2002 , vol. 45, # 5 p. 1079 - 1085 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,5-dichloro-2-methoxy-6-(trichloromethyl)pyridin-4(1h)-one |
| 4-demethylpenclomedine |
| 3,5-dichloro-2-methoxy-4-hydroxy-6-(trichloromethyl)-pyridine |