O,O-bis(2-ethylhexyl) hydrogen thiophosphate structure
|
Common Name | O,O-bis(2-ethylhexyl) hydrogen thiophosphate | ||
|---|---|---|---|---|
| CAS Number | 17618-27-8 | Molecular Weight | 338.48600 | |
| Density | 1.008g/cm3 | Boiling Point | 403ºC at 760mmHg | |
| Molecular Formula | C16H35O3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.5ºC | |
| Name | bis(2-ethylhexoxy)-hydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.008g/cm3 |
|---|---|
| Boiling Point | 403ºC at 760mmHg |
| Molecular Formula | C16H35O3PS |
| Molecular Weight | 338.48600 |
| Flash Point | 197.5ºC |
| Exact Mass | 338.20400 |
| PSA | 80.59000 |
| LogP | 6.31980 |
| Vapour Pressure | 3.59E-08mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | TVRJUOAQXLUUGW-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COP(O)(=S)OCC(CC)CCCC |
| HS Code | 2920190090 |
|---|
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| einecs 241-592-2 |