1'-(phenylmethyl)-[1,4'-bipiperidine]-4'-carboxamide structure
|
Common Name | 1'-(phenylmethyl)-[1,4'-bipiperidine]-4'-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1762-50-1 | Molecular Weight | 301.42600 | |
| Density | 1.142g/cm3 | Boiling Point | 467.7ºC at 760 mmHg | |
| Molecular Formula | C18H27N3O | Melting Point | 137.5-140 °C | |
| MSDS | N/A | Flash Point | 236.6ºC | |
| Name | 1'-Benzyl-1,4'-bipiperidine-4'-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 467.7ºC at 760 mmHg |
| Melting Point | 137.5-140 °C |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.42600 |
| Flash Point | 236.6ºC |
| Exact Mass | 301.21500 |
| PSA | 49.57000 |
| LogP | 2.56850 |
| Vapour Pressure | 6.38E-09mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | YKESGDAJVLVZAA-UHFFFAOYSA-N |
| SMILES | NC(=O)C1(N2CCCCC2)CCN(Cc2ccccc2)CC1 |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-benzyl-4-piperidin-1-ylpiperidine-4-carboxamide |