4-iodo-p-terphenyl
Modify Date: 2026-07-06 10:48:09
4-iodo-p-terphenyl structure
|
Common Name | 4-iodo-p-terphenyl | ||
|---|---|---|---|---|
| CAS Number | 1762-85-2 | Molecular Weight | 356.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H13I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-iodo-4-(4-phenylphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H13I |
|---|---|
| Molecular Weight | 356.20000 |
| Exact Mass | 356.00600 |
| LogP | 5.62520 |
| InChIKey | WEZHMYSASZECSI-UHFFFAOYSA-N |
| SMILES | Ic1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-iodo-p-terphenyl |
| 1,1':4',1''-Terphenyl,4-iodo |
| p-iodoterphenyl |
| 4-iodo-1:1':4':1"-terphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-iodo-4-(4-phenylphenyl)benzene? |
| A: Molecular formula of 1-iodo-4-(4-phenylphenyl)benzene is C18H13I. |
| Q: What is the molecular weight of 1-iodo-4-(4-phenylphenyl)benzene? |
| A: Molecular weight of 1-iodo-4-(4-phenylphenyl)benzene is 356.20000. |
| Q: What is the InChIKey of 1-iodo-4-(4-phenylphenyl)benzene? |
| A: InChIKey of 1-iodo-4-(4-phenylphenyl)benzene is WEZHMYSASZECSI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-iodo-4-(4-phenylphenyl)benzene? |
| A: CAS number of 1-iodo-4-(4-phenylphenyl)benzene is 1762-85-2. |
| Q: What is the LogP of 1-iodo-4-(4-phenylphenyl)benzene? |
| A: LogP of 1-iodo-4-(4-phenylphenyl)benzene is 5.62520. |
| Q: What English synonyms does 1-iodo-4-(4-phenylphenyl)benzene have? |
| A: English synonyms of 1-iodo-4-(4-phenylphenyl)benzene: 4-iodo-p-terphenyl, 1,1':4',1''-Terphenyl,4-iodo, p-iodoterphenyl, 4-iodo-1:1':4':1"-terphenyl. |
| Q: What is the SMILES notation of 1-iodo-4-(4-phenylphenyl)benzene? |
| A: SMILES notation of 1-iodo-4-(4-phenylphenyl)benzene is Ic1ccc(-c2ccc(-c3ccccc3)cc2)cc1. |
| Q: What is the English name of 1-iodo-4-(4-phenylphenyl)benzene? |
| A: The English name of 1-iodo-4-(4-phenylphenyl)benzene is 1-iodo-4-(4-phenylphenyl)benzene. |