Benzenesulfonamide,N-(dibutyl-l4-sulfanylidene)-4-methyl- structure
|
Common Name | Benzenesulfonamide,N-(dibutyl-l4-sulfanylidene)-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 17627-00-8 | Molecular Weight | 315.49500 | |
| Density | 1.12g/cm3 | Boiling Point | 457.9ºC at 760mmHg | |
| Molecular Formula | C15H25NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.7ºC | |
| Name | S,S-dibenzyl gem-diethyl bisoxazoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 457.9ºC at 760mmHg |
| Molecular Formula | C15H25NO2S2 |
| Molecular Weight | 315.49500 |
| Flash Point | 230.7ºC |
| Exact Mass | 315.13300 |
| PSA | 74.09000 |
| LogP | 5.81720 |
| Vapour Pressure | 3.91E-08mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | LUBMPFREPNHNKD-UHFFFAOYSA-N |
| SMILES | CCCCS(CCCC)=NS(=O)(=O)c1ccc(C)cc1 |
|
~91%
Benzenesulfonam... CAS#:17627-00-8 |
| Literature: Giribabu; Singh, Surya P.; Patil, Nandkumar M.; Kantam, M. Lakshmi; Gupte, Sunil P.; Chaudhari, Raghunath V. Synthetic Communications, 2008 , vol. 38, # 4 p. 619 - 625 |
|
~%
Benzenesulfonam... CAS#:17627-00-8 |
| Literature: Todd; Fletcher; Tarbell Journal of the American Chemical Society, 1943 , vol. 65, p. 350,352 |
| S,S-Dibutyl-N-p-tolylsulfonyl-sulfilimin |