4-nitrophenyl glycinate structure
|
Common Name | 4-nitrophenyl glycinate | ||
|---|---|---|---|---|
| CAS Number | 17639-39-3 | Molecular Weight | 196.160 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 358.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.7±23.7 °C | |
| Name | (4-nitrophenyl) 2-aminoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 358.7±27.0 °C at 760 mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.160 |
| Flash Point | 170.7±23.7 °C |
| Exact Mass | 196.048401 |
| PSA | 98.14000 |
| LogP | 0.75 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | KGONNPXPJQKSGN-UHFFFAOYSA-N |
| SMILES | NCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922499990 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| p-nitrophenyl glycinate |
| 4-Nitrophenyl glycinate |
| 4-nitrophenyl aminoacetate |
| 4-nitrophenyl 2-aminoacetate |
| Glycin-(4-nitro-phenylester) |
| p-Nitrophenyl glycine ester |
| Glycin-p-nitrophenylester |
| Glycine, 4-nitrophenyl ester |
| p-Nitrophenyl-glycinat |