2-[4-(hydrazinesulfonyl)phenoxy]acetic acid structure
|
Common Name | 2-[4-(hydrazinesulfonyl)phenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 17641-40-6 | Molecular Weight | 246.24000 | |
| Density | 1.516g/cm3 | Boiling Point | 490.1ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.2ºC | |
| Name | 2-[4-(hydrazinesulfonyl)phenoxy]acetic acid |
|---|
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 490.1ºC at 760 mmHg |
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24000 |
| Flash Point | 250.2ºC |
| Exact Mass | 246.03100 |
| PSA | 127.10000 |
| LogP | 1.47400 |
| Vapour Pressure | 2.03E-10mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | XVCATKOOMCFPIY-UHFFFAOYSA-N |
| SMILES | NNS(=O)(=O)c1ccc(OCC(=O)O)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |