3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-hydroxybenzoic acid structure
|
Common Name | 3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 176442-21-0 | Molecular Weight | 375.37400 | |
| Density | 1.42g/cm3 | Boiling Point | 598.5ºC at 760mmHg | |
| Molecular Formula | C22H17NO5 | Melting Point | 234ºC | |
| MSDS | N/A | Flash Point | 315.8ºC | |
| Name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 598.5ºC at 760mmHg |
| Melting Point | 234ºC |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.37400 |
| Flash Point | 315.8ºC |
| Exact Mass | 375.11100 |
| PSA | 95.86000 |
| LogP | 4.52440 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | WGBZDECNYLZYRE-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(O)cc(C(=O)O)c1)OCC1c2ccccc2-c2ccccc21 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Amino-5-hydroxybenzoic acid,N-FMOC protected |