methyl 6-methoxy-1,2,3,4-tetrahydroquinoline-2-carboxylate structure
|
Common Name | methyl 6-methoxy-1,2,3,4-tetrahydroquinoline-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 176641-35-3 | Molecular Weight | 221.25200 | |
| Density | 1.14g/cm3 | Boiling Point | 361.6ºC at 760mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.5ºC | |
| Name | methyl 6-methoxy-1,2,3,4-tetrahydroquinoline-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 361.6ºC at 760mmHg |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 172.5ºC |
| Exact Mass | 221.10500 |
| PSA | 47.56000 |
| LogP | 1.73290 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | DSKYJEWLFNHBSW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCc2cc(OC)ccc2N1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methoxy-2-methoxycarbonyl-1,2,3,4-tetrahydroquinoline |
| Methyl 6-methoxy-1,2,3,4-tetrahydro-quinoline-2 |
| 6-methoxy-1,2,3,4-tetrahydro-quinoline-2-carboxylic acid methyl ester |