(5S)-5-[(4-phenylmethoxyphenyl)methyl]morpholin-3-one structure
|
Common Name | (5S)-5-[(4-phenylmethoxyphenyl)methyl]morpholin-3-one | ||
|---|---|---|---|---|
| CAS Number | 176685-04-4 | Molecular Weight | 297.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5S)-5-[(4-phenylmethoxyphenyl)methyl]morpholin-3-one |
|---|
| Molecular Formula | C18H19NO3 |
|---|---|
| Molecular Weight | 297.34800 |
| Exact Mass | 297.13600 |
| PSA | 51.05000 |
| LogP | 2.59900 |
| InChIKey | IFCMWOLWIXJJFD-INIZCTEOSA-N |
| SMILES | O=C1COCC(Cc2ccc(OCc3ccccc3)cc2)N1 |
|
~67%
(5S)-5-[(4-phen... CAS#:176685-04-4 |
| Literature: Richter, Jeremy M.; Whitefield, Brandon W.; Maimone, Thomas J.; Lin, David W.; Castroviejo, M. Pilar; Baran, Phil S. Journal of the American Chemical Society, 2007 , vol. 129, # 42 p. 12857 - 12869 |