6-thioguanosine 5'-triphosphate structure
|
Common Name | 6-thioguanosine 5'-triphosphate | ||
|---|---|---|---|---|
| CAS Number | 17670-19-8 | Molecular Weight | 539.24600 | |
| Density | 2.68g/cm3 | Boiling Point | 1014.2ºC at 760mmHg | |
| Molecular Formula | C10H16N5O13P3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 567.1ºC | |
Use of 6-thioguanosine 5'-triphosphate6-Thioguanosine Triphosphate Triethylamine Salt inhibits GTPase Rac1 activation in T lymphocytes and blocks leukocyte transmigration. |
| Name | [[(2R,3S,4R,5S)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.68g/cm3 |
|---|---|
| Boiling Point | 1014.2ºC at 760mmHg |
| Molecular Formula | C10H16N5O13P3S |
| Molecular Weight | 539.24600 |
| Flash Point | 567.1ºC |
| Exact Mass | 538.96800 |
| PSA | 348.09000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.95 |
| InChIKey | QENYANNAQSWPLM-UHFFFAOYSA-N |
| SMILES | Nc1nc(=S)c2ncn(C3OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C3O)c2[nH]1 |
| 9beta-D-Ribofuranosyl-2-amino-6-mercaptopurine 5'-triphosphate |
| 6-Mercapto-GTP |
| 2-Amino-6-mercapto-9-ribofuranosylpurine 5'-triphosphate |
| S6-GTP |
| 6-Thioguanosine 5'-triphosphate |
| 6-thioguanosine triphosphate |
| 6-<35S>Thioguanosin 5'-Triphosphat |
| Thiogtp |