Cytidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy-5-methyl- structure
|
Common Name | Cytidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy-5-methyl- | ||
|---|---|---|---|---|
| CAS Number | 176755-83-2 | Molecular Weight | 543.61 | |
| Density | 1.28±0.1 g/cm3(Predicted) | Boiling Point | 720.3±70.0 °C(Predicted) | |
| Molecular Formula | C31H33N3O6 | Melting Point | 215-217 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cytidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy-5-methyl-2'-Deoxy-5'-O-DMT-5-methylcytidine is a cytidine analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1]. |
| Name | 4-amino-1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-Deoxy-5'-O-DMT-5-methylcytidine is a cytidine analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.28±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 720.3±70.0 °C(Predicted) |
| Melting Point | 215-217 °C |
| Molecular Formula | C31H33N3O6 |
| Molecular Weight | 543.61 |
| Exact Mass | 543.23700 |
| PSA | 119.05000 |
| LogP | 4.15060 |
| InChIKey | COZLXEMWXGXVLK-UPRLRBBYSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cc(C)c(N)nc3=O)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| 5'-O-Dimethoxytrityl-2'-deoxy-5-methylcytidine |
| 5'-O-dimethoxytrityl-5-methyl-2'-deoxycytidine |