5-Chlorocytosine arabinoside structure
|
Common Name | 5-Chlorocytosine arabinoside | ||
|---|---|---|---|---|
| CAS Number | 17676-65-2 | Molecular Weight | 277.66200 | |
| Density | 2.01g/cm3 | Boiling Point | 543.2ºC at 760 mmHg | |
| Molecular Formula | C9H12ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.3ºC | |
| Name | 5-chloro-ara-c |
|---|---|
| Synonym | More Synonyms |
| Density | 2.01g/cm3 |
|---|---|
| Boiling Point | 543.2ºC at 760 mmHg |
| Molecular Formula | C9H12ClN3O5 |
| Molecular Weight | 277.66200 |
| Flash Point | 282.3ºC |
| Exact Mass | 277.04700 |
| PSA | 130.83000 |
| Vapour Pressure | 4.6E-14mmHg at 25°C |
| Index of Refraction | 1.77 |
| InChIKey | LOFVQBRIYOQFDZ-MNCSTQPFSA-N |
| SMILES | Nc1nc(=O)n(C2OC(CO)C(O)C2O)cc1Cl |
| Storage condition | -20°C |
| WGK Germany | 3 |
|---|
|
~83%
5-Chlorocytosin... CAS#:17676-65-2 |
| Literature: Ryu, Eung K.; MacCoss, Malcolm Journal of Organic Chemistry, 1981 , vol. 46, # 13 p. 2819 - 2823 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-chlorocytosine arabinoside*crystalline |
| 5-CHLOROCYTOSINE ARABINO-SIDE |